C22H29ClN4 — CID 145079494
N-[(3-chlorophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-azepane]-2-imine;ethane (PubChem CID 145079494) has the molecular formula C22H29ClN4 and a molecular weight of 384.96 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-azepane]-2-imine;ethane.
| Compound Name | N-[(3-chlorophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-azepane]-2-imine;ethane |
|---|---|
| PubChem CID | 145079494 |
| Molecular Formula | C22H29ClN4 |
| Molecular Weight | 384.96 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-azepane]-2-imine;ethane |
| SMILES | CC.Clc1cccc(C/N=C2\Nc3ccccc3NC23CCCNCC3)c1 |
| InChI | InChI=1S/C20H23ClN4.C2H6/c21-16-6-3-5-15(13-16)14-23-19-20(9-4-11-22-12-10-20)25-18-8-2-1-7-17(18)24-19;1-2/h1-3,5-8,13,22,25H,4,9-12,14H2,(H,23,24);1-2H3 |
| InChIKey | HQMJJEZCZMLSQY-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.96 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|