C21H25ClN4O2 — CID 137105266
N-[(3-chlorophenyl)methyl]-6,7-dimethoxyspiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-imine (PubChem CID 137105266) has the molecular formula C21H25ClN4O2 and a molecular weight of 400.91 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-6,7-dimethoxyspiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-imine.
| Compound Name | N-[(3-chlorophenyl)methyl]-6,7-dimethoxyspiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-imine |
|---|---|
| PubChem CID | 137105266 |
| Molecular Formula | C21H25ClN4O2 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-6,7-dimethoxyspiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-imine |
| SMILES | COc1cc2c(cc1OC)NC1(CCNCC1)/C(=N/Cc1cccc(Cl)c1)N2 |
| InChI | InChI=1S/C21H25ClN4O2/c1-27-18-11-16-17(12-19(18)28-2)26-21(6-8-23-9-7-21)20(25-16)24-13-14-4-3-5-15(22)10-14/h3-5,10-12,23,26H,6-9,13H2,1-2H3,(H,24,25) |
| InChIKey | AISWELZKZJEKNQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|