C24H26ClN3O2 — CID 147248980
1-[7-acetyl-3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,1'-cyclohexane]-6-yl]ethanone (PubChem CID 147248980) has the molecular formula C24H26ClN3O2 and a molecular weight of 423.94 g/mol. Its IUPAC name is 1-[7-acetyl-3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,1'-cyclohexane]-6-yl]ethanone.
| Compound Name | 1-[7-acetyl-3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,1'-cyclohexane]-6-yl]ethanone |
|---|---|
| PubChem CID | 147248980 |
| Molecular Formula | C24H26ClN3O2 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 1-[7-acetyl-3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,1'-cyclohexane]-6-yl]ethanone |
| SMILES | CC(=O)c1cc2c(cc1C(C)=O)NC1(CCCCC1)/C(=N/Cc1cccc(Cl)c1)N2 |
| InChI | InChI=1S/C24H26ClN3O2/c1-15(29)19-12-21-22(13-20(19)16(2)30)28-24(9-4-3-5-10-24)23(27-21)26-14-17-7-6-8-18(25)11-17/h6-8,11-13,28H,3-5,9-10,14H2,1-2H3,(H,26,27) |
| InChIKey | CMHJUVIQGMDDQX-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|