C21H22ClN5O3 — CID 137105335
3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-oxane]-6,7-dicarboxamide (PubChem CID 137105335) has the molecular formula C21H22ClN5O3 and a molecular weight of 427.89 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-oxane]-6,7-dicarboxamide.
| Compound Name | 3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-oxane]-6,7-dicarboxamide |
|---|---|
| PubChem CID | 137105335 |
| Molecular Formula | C21H22ClN5O3 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-oxane]-6,7-dicarboxamide |
| SMILES | NC(=O)c1cc2c(cc1C(N)=O)NC1(CCOCC1)/C(=N/Cc1cccc(Cl)c1)N2 |
| InChI | InChI=1S/C21H22ClN5O3/c22-13-3-1-2-12(8-13)11-25-20-21(4-6-30-7-5-21)27-17-10-15(19(24)29)14(18(23)28)9-16(17)26-20/h1-3,8-10,27H,4-7,11H2,(H2,23,28)(H2,24,29)(H,25,26) |
| InChIKey | LDBYLEGWIZKLHC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|