C21H18ClN5O — CID 137105328
3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-oxane]-5,8-dicarbonitrile (PubChem CID 137105328) has the molecular formula C21H18ClN5O and a molecular weight of 391.86 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-oxane]-5,8-dicarbonitrile.
| Compound Name | 3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-oxane]-5,8-dicarbonitrile |
|---|---|
| PubChem CID | 137105328 |
| Molecular Formula | C21H18ClN5O |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-oxane]-5,8-dicarbonitrile |
| SMILES | N#Cc1ccc(C#N)c2c1N/C(=N\Cc1cccc(Cl)c1)C1(CCOCC1)N2 |
| InChI | InChI=1S/C21H18ClN5O/c22-17-3-1-2-14(10-17)13-25-20-21(6-8-28-9-7-21)27-19-16(12-24)5-4-15(11-23)18(19)26-20/h1-5,10,27H,6-9,13H2,(H,25,26) |
| InChIKey | VUJXQKDHTWJJQF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|