C22H24ClN3O — CID 137146247
N-[(3-chlorophenyl)methyl]-5-prop-2-enylspiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine (PubChem CID 137146247) has the molecular formula C22H24ClN3O and a molecular weight of 381.91 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-5-prop-2-enylspiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine.
| Compound Name | N-[(3-chlorophenyl)methyl]-5-prop-2-enylspiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine |
|---|---|
| PubChem CID | 137146247 |
| Molecular Formula | C22H24ClN3O |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-5-prop-2-enylspiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-imine |
| SMILES | C=CCc1cccc2c1NC1(CCOCC1)/C(=N/Cc1cccc(Cl)c1)N2 |
| InChI | InChI=1S/C22H24ClN3O/c1-2-5-17-7-4-9-19-20(17)26-22(10-12-27-13-11-22)21(25-19)24-15-16-6-3-8-18(23)14-16/h2-4,6-9,14,26H,1,5,10-13,15H2,(H,24,25) |
| InChIKey | RRCBSRFTSHVKPH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|