C21H22Cl2N4O2 — CID 137105450
5-chloro-N-[(3-chlorophenyl)methyl]spiro[2,3,7,10-tetrahydro-[1,4]dioxino[2,3-f]quinoxaline-9,4'-piperidine]-8-imine (PubChem CID 137105450) has the molecular formula C21H22Cl2N4O2 and a molecular weight of 433.34 g/mol. Its IUPAC name is 5-chloro-N-[(3-chlorophenyl)methyl]spiro[2,3,7,10-tetrahydro-[1,4]dioxino[2,3-f]quinoxaline-9,4'-piperidine]-8-imine.
| Compound Name | 5-chloro-N-[(3-chlorophenyl)methyl]spiro[2,3,7,10-tetrahydro-[1,4]dioxino[2,3-f]quinoxaline-9,4'-piperidine]-8-imine |
|---|---|
| PubChem CID | 137105450 |
| Molecular Formula | C21H22Cl2N4O2 |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 5-chloro-N-[(3-chlorophenyl)methyl]spiro[2,3,7,10-tetrahydro-[1,4]dioxino[2,3-f]quinoxaline-9,4'-piperidine]-8-imine |
| SMILES | Clc1cccc(C/N=C2\Nc3cc(Cl)c4c(c3NC23CCNCC3)OCCO4)c1 |
| InChI | InChI=1S/C21H22Cl2N4O2/c22-14-3-1-2-13(10-14)12-25-20-21(4-6-24-7-5-21)27-17-16(26-20)11-15(23)18-19(17)29-9-8-28-18/h1-3,10-11,24,27H,4-9,12H2,(H,25,26) |
| InChIKey | VTKOGTBXCHZFEX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|