C23H30ClN5O — CID 137105334
3-[(3-chlorophenyl)methylimino]-6-N,6-N,7-N,7-N-tetramethylspiro[1,4-dihydroquinoxaline-2,4'-oxane]-6,7-diamine (PubChem CID 137105334) has the molecular formula C23H30ClN5O and a molecular weight of 427.98 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)methylimino]-6-N,6-N,7-N,7-N-tetramethylspiro[1,4-dihydroquinoxaline-2,4'-oxane]-6,7-diamine.
| Compound Name | 3-[(3-chlorophenyl)methylimino]-6-N,6-N,7-N,7-N-tetramethylspiro[1,4-dihydroquinoxaline-2,4'-oxane]-6,7-diamine |
|---|---|
| PubChem CID | 137105334 |
| Molecular Formula | C23H30ClN5O |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 3-[(3-chlorophenyl)methylimino]-6-N,6-N,7-N,7-N-tetramethylspiro[1,4-dihydroquinoxaline-2,4'-oxane]-6,7-diamine |
| SMILES | CN(C)c1cc2c(cc1N(C)C)NC1(CCOCC1)/C(=N/Cc1cccc(Cl)c1)N2 |
| InChI | InChI=1S/C23H30ClN5O/c1-28(2)20-13-18-19(14-21(20)29(3)4)27-23(8-10-30-11-9-23)22(26-18)25-15-16-6-5-7-17(24)12-16/h5-7,12-14,27H,8-11,15H2,1-4H3,(H,25,26) |
| InChIKey | VVAYXMRBMDEIIM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|