C22H19ClN4O — CID 148541154
2-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoline-3,4'-oxane]-5,8-dicarbonitrile (PubChem CID 148541154) has the molecular formula C22H19ClN4O and a molecular weight of 390.87 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoline-3,4'-oxane]-5,8-dicarbonitrile.
| Compound Name | 2-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoline-3,4'-oxane]-5,8-dicarbonitrile |
|---|---|
| PubChem CID | 148541154 |
| Molecular Formula | C22H19ClN4O |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoline-3,4'-oxane]-5,8-dicarbonitrile |
| SMILES | N#Cc1ccc(C#N)c2c1CC1(CCOCC1)/C(=N/Cc1cccc(Cl)c1)N2 |
| InChI | InChI=1S/C22H19ClN4O/c23-18-3-1-2-15(10-18)14-26-21-22(6-8-28-9-7-22)11-19-16(12-24)4-5-17(13-25)20(19)27-21/h1-5,10H,6-9,11,14H2,(H,26,27) |
| InChIKey | MSEPBDWJMJROEL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|