C20H21BrClN3 — CID 149137668
5-bromo-N-[(3-chlorophenyl)methyl]spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-imine (PubChem CID 149137668) has the molecular formula C20H21BrClN3 and a molecular weight of 418.77 g/mol. Its IUPAC name is 5-bromo-N-[(3-chlorophenyl)methyl]spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-imine.
| Compound Name | 5-bromo-N-[(3-chlorophenyl)methyl]spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-imine |
|---|---|
| PubChem CID | 149137668 |
| Molecular Formula | C20H21BrClN3 |
| Molecular Weight | 418.77 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 5-bromo-N-[(3-chlorophenyl)methyl]spiro[1,4-dihydroquinoline-3,4'-piperidine]-2-imine |
| SMILES | Clc1cccc(C/N=C2\Nc3cccc(Br)c3CC23CCNCC3)c1 |
| InChI | InChI=1S/C20H21BrClN3/c21-17-5-2-6-18-16(17)12-20(7-9-23-10-8-20)19(25-18)24-13-14-3-1-4-15(22)11-14/h1-6,11,23H,7-10,12-13H2,(H,24,25) |
| InChIKey | RFWNWDAZOIFGQL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.77 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|