C21H23ClN4O — CID 137105165
3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,1'-cyclohexane]-6-carboxamide (PubChem CID 137105165) has the molecular formula C21H23ClN4O and a molecular weight of 382.90 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,1'-cyclohexane]-6-carboxamide.
| Compound Name | 3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,1'-cyclohexane]-6-carboxamide |
|---|---|
| PubChem CID | 137105165 |
| Molecular Formula | C21H23ClN4O |
| Molecular Weight | 382.90 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,1'-cyclohexane]-6-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)N/C(=N\Cc1cccc(Cl)c1)C1(CCCCC1)N2 |
| InChI | InChI=1S/C21H23ClN4O/c22-16-6-4-5-14(11-16)13-24-20-21(9-2-1-3-10-21)26-17-8-7-15(19(23)27)12-18(17)25-20/h4-8,11-12,26H,1-3,9-10,13H2,(H2,23,27)(H,24,25) |
| InChIKey | FTGOISBRJRJAIG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.90 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|