C23H28ClN3O — CID 137105405
N-[(3-chlorophenyl)methyl]-7-(2-methoxyethyl)spiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-imine (PubChem CID 137105405) has the molecular formula C23H28ClN3O and a molecular weight of 397.95 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-7-(2-methoxyethyl)spiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-imine.
| Compound Name | N-[(3-chlorophenyl)methyl]-7-(2-methoxyethyl)spiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-imine |
|---|---|
| PubChem CID | 137105405 |
| Molecular Formula | C23H28ClN3O |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-7-(2-methoxyethyl)spiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-imine |
| SMILES | COCCc1ccc2c(c1)N/C(=N\Cc1cccc(Cl)c1)C1(CCCCC1)N2 |
| InChI | InChI=1S/C23H28ClN3O/c1-28-13-10-17-8-9-20-21(15-17)26-22(23(27-20)11-3-2-4-12-23)25-16-18-6-5-7-19(24)14-18/h5-9,14-15,27H,2-4,10-13,16H2,1H3,(H,25,26) |
| InChIKey | JOGYFCCYFVFERQ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|