C20H22ClN3OS — CID 137105136
N-[(3-chlorophenyl)methyl]-7-methoxyspiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-imine (PubChem CID 137105136) has the molecular formula C20H22ClN3OS and a molecular weight of 387.94 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-7-methoxyspiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-imine.
| Compound Name | N-[(3-chlorophenyl)methyl]-7-methoxyspiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-imine |
|---|---|
| PubChem CID | 137105136 |
| Molecular Formula | C20H22ClN3OS |
| Molecular Weight | 387.94 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-7-methoxyspiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-imine |
| SMILES | COc1ccc2c(c1)N/C(=N\Cc1cccc(Cl)c1)C1(CCSCC1)N2 |
| InChI | InChI=1S/C20H22ClN3OS/c1-25-16-5-6-17-18(12-16)23-19(20(24-17)7-9-26-10-8-20)22-13-14-3-2-4-15(21)11-14/h2-6,11-12,24H,7-10,13H2,1H3,(H,22,23) |
| InChIKey | NTAWRVOIPUYBTJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.94 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|