C20H22ClN4Si — CID 137099323
CID 137099323 (PubChem CID 137099323) has the molecular formula C20H22ClN4Si and a molecular weight of 381.96 g/mol.
| Compound Name | CID 137099323 |
|---|---|
| PubChem CID | 137099323 |
| Molecular Formula | C20H22ClN4Si |
| Molecular Weight | 381.96 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | — |
| SMILES | [Si]N1CCCC2(CC1)Nc1ccccc1N/C2=N\Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H22ClN4Si/c21-16-6-3-5-15(13-16)14-22-19-20(9-4-11-25(26)12-10-20)24-18-8-2-1-7-17(18)23-19/h1-3,5-8,13,24H,4,9-12,14H2,(H,22,23) |
| InChIKey | LVCHXOWYZBWHML-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.96 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|