About CID 137099323
CID 137099323 (PubChem CID 137099323) has the molecular formula C20H22ClN4Si
and a molecular weight of 381.96 g/mol.
Molecular Properties
| Compound Name | CID 137099323 |
| PubChem CID | 137099323 |
| Molecular Formula | C20H22ClN4Si |
| Molecular Weight | 381.96 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | — |
| SMILES | [Si]N1CCCC2(CC1)Nc1ccccc1N/C2=N\Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H22ClN4Si/c21-16-6-3-5-15(13-16)14-22-19-20(9-4-11-25(26)12-10-20)24-18-8-2-1-7-17(18)23-19/h1-3,5-8,13,24H,4,9-12,14H2,(H,22,23) |
| InChIKey | LVCHXOWYZBWHML-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.96 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 137099323 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 137099323?
The IUPAC name of CID 137099323 (CID 137099323) is not available.
What is the SMILES notation for CID 137099323?
The canonical SMILES for CID 137099323 is [Si]N1CCCC2(CC1)Nc1ccccc1N/C2=N\Cc1cccc(Cl)c1.
What is the InChIKey of CID 137099323?
The InChIKey is LVCHXOWYZBWHML-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22ClN4Si/c21-16-6-3-5-15(13-16)14-22-19-20(9-4-11-25(26)12-10-20)24-18-8-2-1-7-17(18)23-19/h1-3,5-8,13,24H,4,9-12,14H2,(H,22,23).
What are the key properties of CID 137099323?
CID 137099323 has a molecular weight of 381.96 g/mol, XLogP of 4.08, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 137099323 is sourced from PubChem (CID 137099323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).