C22H27ClN4O — CID 137105509
2-[3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-cyclohexane]-1'-yl]oxyethanamine (PubChem CID 137105509) has the molecular formula C22H27ClN4O and a molecular weight of 398.94 g/mol. Its IUPAC name is 2-[3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-cyclohexane]-1'-yl]oxyethanamine.
| Compound Name | 2-[3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-cyclohexane]-1'-yl]oxyethanamine |
|---|---|
| PubChem CID | 137105509 |
| Molecular Formula | C22H27ClN4O |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 2-[3-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-cyclohexane]-1'-yl]oxyethanamine |
| SMILES | NCCOC1CCC2(CC1)Nc1ccccc1N/C2=N\Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H27ClN4O/c23-17-5-3-4-16(14-17)15-25-21-22(10-8-18(9-11-22)28-13-12-24)27-20-7-2-1-6-19(20)26-21/h1-7,14,18,27H,8-13,15,24H2,(H,25,26) |
| InChIKey | OBTHOFSATIIANR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|