About 3-benzyliminospiro[1,4-dihydroquinoxaline-2,4'-cyclohexane]-1'-amine;ethane
3-benzyliminospiro[1,4-dihydroquinoxaline-2,4'-cyclohexane]-1'-amine;ethane (PubChem CID 145079364) has the molecular formula C22H30N4
and a molecular weight of 350.51 g/mol. Its IUPAC name is 3-benzyliminospiro[1,4-dihydroquinoxaline-2,4'-cyclohexane]-1'-amine;ethane.
Molecular Properties
| Compound Name | 3-benzyliminospiro[1,4-dihydroquinoxaline-2,4'-cyclohexane]-1'-amine;ethane |
| PubChem CID | 145079364 |
| Molecular Formula | C22H30N4 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | 3-benzyliminospiro[1,4-dihydroquinoxaline-2,4'-cyclohexane]-1'-amine;ethane |
| SMILES | CC.NC1CCC2(CC1)Nc1ccccc1N/C2=N\Cc1ccccc1 |
| InChI | InChI=1S/C20H24N4.C2H6/c21-16-10-12-20(13-11-16)19(22-14-15-6-2-1-3-7-15)23-17-8-4-5-9-18(17)24-20;1-2/h1-9,16,24H,10-14,21H2,(H,22,23);1-2H3 |
| InChIKey | MJQFOOGHRINKKA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyliminospiro[1,4-dihydroquinoxaline-2,4'-cyclohexane]-1'-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyliminospiro[1,4-dihydroquinoxaline-2,4'-cyclohexane]-1'-amine;ethane?
The IUPAC name of 3-benzyliminospiro[1,4-dihydroquinoxaline-2,4'-cyclohexane]-1'-amine;ethane (CID 145079364) is 3-benzyliminospiro[1,4-dihydroquinoxaline-2,4'-cyclohexane]-1'-amine;ethane.
What is the SMILES notation for 3-benzyliminospiro[1,4-dihydroquinoxaline-2,4'-cyclohexane]-1'-amine;ethane?
The canonical SMILES for 3-benzyliminospiro[1,4-dihydroquinoxaline-2,4'-cyclohexane]-1'-amine;ethane is CC.NC1CCC2(CC1)Nc1ccccc1N/C2=N\Cc1ccccc1.
What is the InChIKey of 3-benzyliminospiro[1,4-dihydroquinoxaline-2,4'-cyclohexane]-1'-amine;ethane?
The InChIKey is MJQFOOGHRINKKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4.C2H6/c21-16-10-12-20(13-11-16)19(22-14-15-6-2-1-3-7-15)23-17-8-4-5-9-18(17)24-20;1-2/h1-9,16,24H,10-14,21H2,(H,22,23);1-2H3.
What are the key properties of 3-benzyliminospiro[1,4-dihydroquinoxaline-2,4'-cyclohexane]-1'-amine;ethane?
3-benzyliminospiro[1,4-dihydroquinoxaline-2,4'-cyclohexane]-1'-amine;ethane has a molecular weight of 350.51 g/mol, XLogP of 4.79, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyliminospiro[1,4-dihydroquinoxaline-2,4'-cyclohexane]-1'-amine;ethane is sourced from PubChem (CID 145079364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).