C22H30N4 — CID 145079364
3-benzyliminospiro[1,4-dihydroquinoxaline-2,4'-cyclohexane]-1'-amine;ethane (PubChem CID 145079364) has the molecular formula C22H30N4 and a molecular weight of 350.51 g/mol. Its IUPAC name is 3-benzyliminospiro[1,4-dihydroquinoxaline-2,4'-cyclohexane]-1'-amine;ethane.
| Compound Name | 3-benzyliminospiro[1,4-dihydroquinoxaline-2,4'-cyclohexane]-1'-amine;ethane |
|---|---|
| PubChem CID | 145079364 |
| Molecular Formula | C22H30N4 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | 3-benzyliminospiro[1,4-dihydroquinoxaline-2,4'-cyclohexane]-1'-amine;ethane |
| SMILES | CC.NC1CCC2(CC1)Nc1ccccc1N/C2=N\Cc1ccccc1 |
| InChI | InChI=1S/C20H24N4.C2H6/c21-16-10-12-20(13-11-16)19(22-14-15-6-2-1-3-7-15)23-17-8-4-5-9-18(17)24-20;1-2/h1-9,16,24H,10-14,21H2,(H,22,23);1-2H3 |
| InChIKey | MJQFOOGHRINKKA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|