C19H21BrN4 — CID 137105248
N-[(4-bromophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-imine (PubChem CID 137105248) has the molecular formula C19H21BrN4 and a molecular weight of 385.31 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-imine.
| Compound Name | N-[(4-bromophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-imine |
|---|---|
| PubChem CID | 137105248 |
| Molecular Formula | C19H21BrN4 |
| Molecular Weight | 385.31 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | N-[(4-bromophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-imine |
| SMILES | Brc1ccc(C/N=C2\Nc3ccccc3NC23CCNCC3)cc1 |
| InChI | InChI=1S/C19H21BrN4/c20-15-7-5-14(6-8-15)13-22-18-19(9-11-21-12-10-19)24-17-4-2-1-3-16(17)23-18/h1-8,21,24H,9-13H2,(H,22,23) |
| InChIKey | HHVOLLYMBNUNDY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|