C23H28ClN3O — CID 153160658
2-[2-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoline-3,4'-cyclohexane]-1'-yl]oxyethanamine (PubChem CID 153160658) has the molecular formula C23H28ClN3O and a molecular weight of 397.95 g/mol. Its IUPAC name is 2-[2-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoline-3,4'-cyclohexane]-1'-yl]oxyethanamine.
| Compound Name | 2-[2-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoline-3,4'-cyclohexane]-1'-yl]oxyethanamine |
|---|---|
| PubChem CID | 153160658 |
| Molecular Formula | C23H28ClN3O |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 2-[2-[(3-chlorophenyl)methylimino]spiro[1,4-dihydroquinoline-3,4'-cyclohexane]-1'-yl]oxyethanamine |
| SMILES | NCCOC1CCC2(CC1)Cc1ccccc1N/C2=N\Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H28ClN3O/c24-19-6-3-4-17(14-19)16-26-22-23(10-8-20(9-11-23)28-13-12-25)15-18-5-1-2-7-21(18)27-22/h1-7,14,20H,8-13,15-16,25H2,(H,26,27) |
| InChIKey | WCHMIZQGYUAFOC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|