C22H26ClN3 — CID 162087932
N-[(3-chlorophenyl)methyl]-1'-methylspiro[1,4-dihydroquinoline-3,3'-azepane]-2-imine (PubChem CID 162087932) has the molecular formula C22H26ClN3 and a molecular weight of 367.92 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-1'-methylspiro[1,4-dihydroquinoline-3,3'-azepane]-2-imine.
| Compound Name | N-[(3-chlorophenyl)methyl]-1'-methylspiro[1,4-dihydroquinoline-3,3'-azepane]-2-imine |
|---|---|
| PubChem CID | 162087932 |
| Molecular Formula | C22H26ClN3 |
| Molecular Weight | 367.92 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-1'-methylspiro[1,4-dihydroquinoline-3,3'-azepane]-2-imine |
| SMILES | CN1CCCCC2(Cc3ccccc3N/C2=N\Cc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C22H26ClN3/c1-26-12-5-4-11-22(16-26)14-18-8-2-3-10-20(18)25-21(22)24-15-17-7-6-9-19(23)13-17/h2-3,6-10,13H,4-5,11-12,14-16H2,1H3,(H,24,25) |
| InChIKey | ZDFGEWKUKUJEET-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.92 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|