C23H26ClN3OS — CID 162119471
2-[(3-chlorophenyl)methylimino]-N,N-dimethylspiro[1,4-dihydroquinoline-3,4'-thiane]-6-carboxamide (PubChem CID 162119471) has the molecular formula C23H26ClN3OS and a molecular weight of 428.00 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methylimino]-N,N-dimethylspiro[1,4-dihydroquinoline-3,4'-thiane]-6-carboxamide.
| Compound Name | 2-[(3-chlorophenyl)methylimino]-N,N-dimethylspiro[1,4-dihydroquinoline-3,4'-thiane]-6-carboxamide |
|---|---|
| PubChem CID | 162119471 |
| Molecular Formula | C23H26ClN3OS |
| Molecular Weight | 428.00 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 2-[(3-chlorophenyl)methylimino]-N,N-dimethylspiro[1,4-dihydroquinoline-3,4'-thiane]-6-carboxamide |
| SMILES | CN(C)C(=O)c1ccc2c(c1)CC1(CCSCC1)/C(=N/Cc1cccc(Cl)c1)N2 |
| InChI | InChI=1S/C23H26ClN3OS/c1-27(2)21(28)17-6-7-20-18(13-17)14-23(8-10-29-11-9-23)22(26-20)25-15-16-4-3-5-19(24)12-16/h3-7,12-13H,8-11,14-15H2,1-2H3,(H,25,26) |
| InChIKey | ZHFHYPGREAXKEK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.00 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|