C23H27N3OS — CID 147873972
N,N-dimethyl-2-[(spiro[1,4-dihydroquinoline-3,4'-thiane]-2-ylideneamino)methyl]benzamide (PubChem CID 147873972) has the molecular formula C23H27N3OS and a molecular weight of 393.56 g/mol. Its IUPAC name is N,N-dimethyl-2-[(spiro[1,4-dihydroquinoline-3,4'-thiane]-2-ylideneamino)methyl]benzamide.
| Compound Name | N,N-dimethyl-2-[(spiro[1,4-dihydroquinoline-3,4'-thiane]-2-ylideneamino)methyl]benzamide |
|---|---|
| PubChem CID | 147873972 |
| Molecular Formula | C23H27N3OS |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | N,N-dimethyl-2-[(spiro[1,4-dihydroquinoline-3,4'-thiane]-2-ylideneamino)methyl]benzamide |
| SMILES | CN(C)C(=O)c1ccccc1C/N=C1\Nc2ccccc2CC12CCSCC2 |
| InChI | InChI=1S/C23H27N3OS/c1-26(2)21(27)19-9-5-3-8-18(19)16-24-22-23(11-13-28-14-12-23)15-17-7-4-6-10-20(17)25-22/h3-10H,11-16H2,1-2H3,(H,24,25) |
| InChIKey | HZDNCVZIXGQDOX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|