C22H26N4O — CID 137248268
N-methyl-2-[(spiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-ylideneamino)methyl]benzamide (PubChem CID 137248268) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is N-methyl-2-[(spiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-ylideneamino)methyl]benzamide.
| Compound Name | N-methyl-2-[(spiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-ylideneamino)methyl]benzamide |
|---|---|
| PubChem CID | 137248268 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | N-methyl-2-[(spiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-ylideneamino)methyl]benzamide |
| SMILES | CNC(=O)c1ccccc1C/N=C1\Nc2ccccc2NC12CCCCC2 |
| InChI | InChI=1S/C22H26N4O/c1-23-20(27)17-10-4-3-9-16(17)15-24-21-22(13-7-2-8-14-22)26-19-12-6-5-11-18(19)25-21/h3-6,9-12,26H,2,7-8,13-15H2,1H3,(H,23,27)(H,24,25) |
| InChIKey | VMDDYEZHHWLLNZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|