C23H28N4S — CID 137104740
N-[(2-pyrrolidin-1-ylphenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-imine (PubChem CID 137104740) has the molecular formula C23H28N4S and a molecular weight of 392.57 g/mol. Its IUPAC name is N-[(2-pyrrolidin-1-ylphenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-imine.
| Compound Name | N-[(2-pyrrolidin-1-ylphenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-imine |
|---|---|
| PubChem CID | 137104740 |
| Molecular Formula | C23H28N4S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | N-[(2-pyrrolidin-1-ylphenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-imine |
| SMILES | c1ccc(N2CCCC2)c(C/N=C2\Nc3ccccc3NC23CCSCC3)c1 |
| InChI | InChI=1S/C23H28N4S/c1-4-10-21(27-13-5-6-14-27)18(7-1)17-24-22-23(11-15-28-16-12-23)26-20-9-3-2-8-19(20)25-22/h1-4,7-10,26H,5-6,11-17H2,(H,24,25) |
| InChIKey | YTVKWYYKVFGIMV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|