C19H18Cl2FN3S — CID 137104968
N-[(2,4-dichloro-5-fluorophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-imine (PubChem CID 137104968) has the molecular formula C19H18Cl2FN3S and a molecular weight of 410.35 g/mol. Its IUPAC name is N-[(2,4-dichloro-5-fluorophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-imine.
| Compound Name | N-[(2,4-dichloro-5-fluorophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-imine |
|---|---|
| PubChem CID | 137104968 |
| Molecular Formula | C19H18Cl2FN3S |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | N-[(2,4-dichloro-5-fluorophenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-imine |
| SMILES | Fc1cc(C/N=C2\Nc3ccccc3NC23CCSCC3)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H18Cl2FN3S/c20-13-10-14(21)15(22)9-12(13)11-23-18-19(5-7-26-8-6-19)25-17-4-2-1-3-16(17)24-18/h1-4,9-10,25H,5-8,11H2,(H,23,24) |
| InChIKey | ZPNXWSKXKIMDDQ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|