C20H23N3O2S2 — CID 137104969
N-[(3-methylsulfonylphenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-imine (PubChem CID 137104969) has the molecular formula C20H23N3O2S2 and a molecular weight of 401.56 g/mol. Its IUPAC name is N-[(3-methylsulfonylphenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-imine.
| Compound Name | N-[(3-methylsulfonylphenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-imine |
|---|---|
| PubChem CID | 137104969 |
| Molecular Formula | C20H23N3O2S2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-[(3-methylsulfonylphenyl)methyl]spiro[1,4-dihydroquinoxaline-3,4'-thiane]-2-imine |
| SMILES | CS(=O)(=O)c1cccc(C/N=C2\Nc3ccccc3NC23CCSCC3)c1 |
| InChI | InChI=1S/C20H23N3O2S2/c1-27(24,25)16-6-4-5-15(13-16)14-21-19-20(9-11-26-12-10-20)23-18-8-3-2-7-17(18)22-19/h2-8,13,23H,9-12,14H2,1H3,(H,21,22) |
| InChIKey | ANIUHOANGSITJJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|