C22H21Cl2F3N2 — CID 158796931
6,7-dichloro-N-[[3-(trifluoromethyl)phenyl]methyl]spiro[1,4-dihydroquinoline-3,1'-cyclohexane]-2-imine (PubChem CID 158796931) has the molecular formula C22H21Cl2F3N2 and a molecular weight of 441.32 g/mol. Its IUPAC name is 6,7-dichloro-N-[[3-(trifluoromethyl)phenyl]methyl]spiro[1,4-dihydroquinoline-3,1'-cyclohexane]-2-imine.
| Compound Name | 6,7-dichloro-N-[[3-(trifluoromethyl)phenyl]methyl]spiro[1,4-dihydroquinoline-3,1'-cyclohexane]-2-imine |
|---|---|
| PubChem CID | 158796931 |
| Molecular Formula | C22H21Cl2F3N2 |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 6,7-dichloro-N-[[3-(trifluoromethyl)phenyl]methyl]spiro[1,4-dihydroquinoline-3,1'-cyclohexane]-2-imine |
| SMILES | FC(F)(F)c1cccc(C/N=C2\Nc3cc(Cl)c(Cl)cc3CC23CCCCC3)c1 |
| InChI | InChI=1S/C22H21Cl2F3N2/c23-17-10-15-12-21(7-2-1-3-8-21)20(29-19(15)11-18(17)24)28-13-14-5-4-6-16(9-14)22(25,26)27/h4-6,9-11H,1-3,7-8,12-13H2,(H,28,29) |
| InChIKey | ISYZCMKFCOSRQE-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|