C22H29N5 — CID 145079424
N,N-dimethyl-3-[(3-methylphenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-piperidine]-5-amine (PubChem CID 145079424) has the molecular formula C22H29N5 and a molecular weight of 363.51 g/mol. Its IUPAC name is N,N-dimethyl-3-[(3-methylphenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-piperidine]-5-amine.
| Compound Name | N,N-dimethyl-3-[(3-methylphenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-piperidine]-5-amine |
|---|---|
| PubChem CID | 145079424 |
| Molecular Formula | C22H29N5 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | N,N-dimethyl-3-[(3-methylphenyl)methylimino]spiro[1,4-dihydroquinoxaline-2,4'-piperidine]-5-amine |
| SMILES | Cc1cccc(C/N=C2\Nc3c(cccc3N(C)C)NC23CCNCC3)c1 |
| InChI | InChI=1S/C22H29N5/c1-16-6-4-7-17(14-16)15-24-21-22(10-12-23-13-11-22)26-18-8-5-9-19(27(2)3)20(18)25-21/h4-9,14,23,26H,10-13,15H2,1-3H3,(H,24,25) |
| InChIKey | OBNSGCGXUAVAPK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 51.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|