C12H13NO6 — CID 175230643
(E)-but-2-enedioic acid;N-(2-hydroxyphenyl)acetamide (PubChem CID 175230643) has the molecular formula C12H13NO6 and a molecular weight of 267.24 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-(2-hydroxyphenyl)acetamide.
| Compound Name | (E)-but-2-enedioic acid;N-(2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 175230643 |
| Molecular Formula | C12H13NO6 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | (E)-but-2-enedioic acid;N-(2-hydroxyphenyl)acetamide |
| SMILES | CC(=O)Nc1ccccc1O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C8H9NO2.C4H4O4/c1-6(10)9-7-4-2-3-5-8(7)11;5-3(6)1-2-4(7)8/h2-5,11H,1H3,(H,9,10);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | GPICLKSURWGADU-WLHGVMLRSA-N |
| XLogP | 1.06 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|