About 4-bromophenol;N-(2-hydroxyphenyl)acetamide
4-bromophenol;N-(2-hydroxyphenyl)acetamide (PubChem CID 175122442) has the molecular formula C14H14BrNO3
and a molecular weight of 324.17 g/mol. Its IUPAC name is 4-bromophenol;N-(2-hydroxyphenyl)acetamide.
Molecular Properties
| Compound Name | 4-bromophenol;N-(2-hydroxyphenyl)acetamide |
| PubChem CID | 175122442 |
| Molecular Formula | C14H14BrNO3 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 4-bromophenol;N-(2-hydroxyphenyl)acetamide |
| SMILES | CC(=O)Nc1ccccc1O.Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C8H9NO2.C6H5BrO/c1-6(10)9-7-4-2-3-5-8(7)11;7-5-1-3-6(8)4-2-5/h2-5,11H,1H3,(H,9,10);1-4,8H |
| InChIKey | KFCSTRVRJSZNGL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-bromophenol;N-(2-hydroxyphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromophenol;N-(2-hydroxyphenyl)acetamide?
The IUPAC name of 4-bromophenol;N-(2-hydroxyphenyl)acetamide (CID 175122442) is 4-bromophenol;N-(2-hydroxyphenyl)acetamide.
What is the SMILES notation for 4-bromophenol;N-(2-hydroxyphenyl)acetamide?
The canonical SMILES for 4-bromophenol;N-(2-hydroxyphenyl)acetamide is CC(=O)Nc1ccccc1O.Oc1ccc(Br)cc1.
What is the InChIKey of 4-bromophenol;N-(2-hydroxyphenyl)acetamide?
The InChIKey is KFCSTRVRJSZNGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.C6H5BrO/c1-6(10)9-7-4-2-3-5-8(7)11;7-5-1-3-6(8)4-2-5/h2-5,11H,1H3,(H,9,10);1-4,8H.
What are the key properties of 4-bromophenol;N-(2-hydroxyphenyl)acetamide?
4-bromophenol;N-(2-hydroxyphenyl)acetamide has a molecular weight of 324.17 g/mol, XLogP of 3.51, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromophenol;N-(2-hydroxyphenyl)acetamide is sourced from PubChem (CID 175122442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).