C10H8N2O3 — CID 174941775
1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione;furan (PubChem CID 174941775) has the molecular formula C10H8N2O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is 1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione;furan.
| Compound Name | 1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione;furan |
|---|---|
| PubChem CID | 174941775 |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione;furan |
| SMILES | O=C1Nc2cc[nH]c2C1=O.c1ccoc1 |
| InChI | InChI=1S/C6H4N2O2.C4H4O/c9-5-4-3(1-2-7-4)8-6(5)10;1-2-4-5-3-1/h1-2,7H,(H,8,9,10);1-4H |
| InChIKey | WHEAAKQUDJZWSB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 75.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|