C7H4N2O3 — CID 146048162
1,4-dihydropyrrolo[3,2-b]pyridine-2,3,5-trione (PubChem CID 146048162) has the molecular formula C7H4N2O3 and a molecular weight of 164.12 g/mol. Its IUPAC name is 1,4-dihydropyrrolo[3,2-b]pyridine-2,3,5-trione.
| Compound Name | 1,4-dihydropyrrolo[3,2-b]pyridine-2,3,5-trione |
|---|---|
| PubChem CID | 146048162 |
| Molecular Formula | C7H4N2O3 |
| Molecular Weight | 164.12 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | 1,4-dihydropyrrolo[3,2-b]pyridine-2,3,5-trione |
| SMILES | O=C1Nc2ccc(=O)[nH]c2C1=O |
| InChI | InChI=1S/C7H4N2O3/c10-4-2-1-3-5(9-4)6(11)7(12)8-3/h1-2H,(H,9,10)(H,8,11,12) |
| InChIKey | OJPDWDDLDCCSPR-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.12 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|