C6H3ClN2O2 — CID 174763729
2-chloro-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione (PubChem CID 174763729) has the molecular formula C6H3ClN2O2 and a molecular weight of 170.56 g/mol. Its IUPAC name is 2-chloro-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione.
| Compound Name | 2-chloro-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione |
|---|---|
| PubChem CID | 174763729 |
| Molecular Formula | C6H3ClN2O2 |
| Molecular Weight | 170.56 g/mol |
| Exact Mass | 169.99 |
| IUPAC Name | 2-chloro-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione |
| SMILES | O=C1Nc2cc(Cl)[nH]c2C1=O |
| InChI | InChI=1S/C6H3ClN2O2/c7-3-1-2-4(9-3)5(10)6(11)8-2/h1,9H,(H,8,10,11) |
| InChIKey | GJBFOPUEEVJOEG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.56 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|