C11H7N3O2 — CID 175097917
2-pyridin-2-yl-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione (PubChem CID 175097917) has the molecular formula C11H7N3O2 and a molecular weight of 213.20 g/mol. Its IUPAC name is 2-pyridin-2-yl-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione.
| Compound Name | 2-pyridin-2-yl-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione |
|---|---|
| PubChem CID | 175097917 |
| Molecular Formula | C11H7N3O2 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 2-pyridin-2-yl-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione |
| SMILES | O=C1Nc2cc(-c3ccccn3)[nH]c2C1=O |
| InChI | InChI=1S/C11H7N3O2/c15-10-9-8(14-11(10)16)5-7(13-9)6-3-1-2-4-12-6/h1-5,13H,(H,14,15,16) |
| InChIKey | KQCYFTDSVFLIRQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|