C12H8OS2 — CID 142807871
5-methylthieno[2,3-b]thiochromen-4-one (PubChem CID 142807871) has the molecular formula C12H8OS2 and a molecular weight of 232.33 g/mol. Its IUPAC name is 5-methylthieno[2,3-b]thiochromen-4-one.
| Compound Name | 5-methylthieno[2,3-b]thiochromen-4-one |
|---|---|
| PubChem CID | 142807871 |
| Molecular Formula | C12H8OS2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.00 |
| IUPAC Name | 5-methylthieno[2,3-b]thiochromen-4-one |
| SMILES | Cc1cccc2sc3sccc3c(=O)c12 |
| InChI | InChI=1S/C12H8OS2/c1-7-3-2-4-9-10(7)11(13)8-5-6-14-12(8)15-9/h2-6H,1H3 |
| InChIKey | KGKFSKIAKXAKRL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |