C21H10O5S — CID 122658770
5-hydroxy-16-methyl-12-thiapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),4(9),5,7,15,17,19-octaene-3,10,14,21-tetrone (PubChem CID 122658770) has the molecular formula C21H10O5S and a molecular weight of 374.37 g/mol. Its IUPAC name is 5-hydroxy-16-methyl-12-thiapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),4(9),5,7,15,17,19-octaene-3,10,14,21-tetrone.
| Compound Name | 5-hydroxy-16-methyl-12-thiapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),4(9),5,7,15,17,19-octaene-3,10,14,21-tetrone |
|---|---|
| PubChem CID | 122658770 |
| Molecular Formula | C21H10O5S |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 5-hydroxy-16-methyl-12-thiapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),4(9),5,7,15,17,19-octaene-3,10,14,21-tetrone |
| SMILES | Cc1cccc2c(=O)c3c(sc4c(=O)c5cccc(O)c5c(=O)c43)c(=O)c12 |
| InChI | InChI=1S/C21H10O5S/c1-8-4-2-5-9-12(8)19(26)21-14(16(9)23)15-18(25)13-10(6-3-7-11(13)22)17(24)20(15)27-21/h2-7,22H,1H3 |
| InChIKey | MXRYBIYTHSBBDN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|