C23H10F3NO5S — CID 122658768
2,2,2-trifluoro-N-(16-methyl-3,10,14,21-tetraoxo-12-thiapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),4(9),5,7,15,17,19-octaen-5-yl)acetamide (PubChem CID 122658768) has the molecular formula C23H10F3NO5S and a molecular weight of 469.40 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(16-methyl-3,10,14,21-tetraoxo-12-thiapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),4(9),5,7,15,17,19-octaen-5-yl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(16-methyl-3,10,14,21-tetraoxo-12-thiapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),4(9),5,7,15,17,19-octaen-5-yl)acetamide |
|---|---|
| PubChem CID | 122658768 |
| Molecular Formula | C23H10F3NO5S |
| Molecular Weight | 469.40 g/mol |
| Exact Mass | 469.02 |
| IUPAC Name | 2,2,2-trifluoro-N-(16-methyl-3,10,14,21-tetraoxo-12-thiapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(13),2(11),4(9),5,7,15,17,19-octaen-5-yl)acetamide |
| SMILES | Cc1cccc2c(=O)c3c(sc4c(=O)c5cccc(NC(=O)C(F)(F)F)c5c(=O)c43)c(=O)c12 |
| InChI | InChI=1S/C23H10F3NO5S/c1-8-4-2-5-9-12(8)19(31)21-14(16(9)28)15-18(30)13-10(17(29)20(15)33-21)6-3-7-11(13)27-22(32)23(24,25)26/h2-7H,1H3,(H,27,32) |
| InChIKey | DTBLRWSSHOFMPA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|