C8H6N2O2 — CID 58564732
1,4-dihydro-1,6-naphthyridine-2,3-dione (PubChem CID 58564732) has the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. Its IUPAC name is 1,4-dihydro-1,6-naphthyridine-2,3-dione.
| Compound Name | 1,4-dihydro-1,6-naphthyridine-2,3-dione |
|---|---|
| PubChem CID | 58564732 |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 1,4-dihydro-1,6-naphthyridine-2,3-dione |
| SMILES | O=C1Cc2cnccc2NC1=O |
| InChI | InChI=1S/C8H6N2O2/c11-7-3-5-4-9-2-1-6(5)10-8(7)12/h1-2,4H,3H2,(H,10,12) |
| InChIKey | ACBOKSXQVANFAD-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|