About 2,3-dihydropyrrolo[3,4-c]pyridin-1-one;hydrochloride
2,3-dihydropyrrolo[3,4-c]pyridin-1-one;hydrochloride (PubChem CID 141389708) has the molecular formula C7H7ClN2O
and a molecular weight of 170.60 g/mol. Its IUPAC name is 2,3-dihydropyrrolo[3,4-c]pyridin-1-one;hydrochloride.
Analyze 2,3-dihydropyrrolo[3,4-c]pyridin-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydropyrrolo[3,4-c]pyridin-1-one;hydrochloride?
The IUPAC name of 2,3-dihydropyrrolo[3,4-c]pyridin-1-one;hydrochloride (CID 141389708) is 2,3-dihydropyrrolo[3,4-c]pyridin-1-one;hydrochloride.
What is the SMILES notation for 2,3-dihydropyrrolo[3,4-c]pyridin-1-one;hydrochloride?
The canonical SMILES for 2,3-dihydropyrrolo[3,4-c]pyridin-1-one;hydrochloride is Cl.O=C1NCc2cnccc21.
What is the InChIKey of 2,3-dihydropyrrolo[3,4-c]pyridin-1-one;hydrochloride?
The InChIKey is IKSKXUQAHFJEPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O.ClH/c10-7-6-1-2-8-3-5(6)4-9-7;/h1-3H,4H2,(H,9,10);1H.
What are the key properties of 2,3-dihydropyrrolo[3,4-c]pyridin-1-one;hydrochloride?
2,3-dihydropyrrolo[3,4-c]pyridin-1-one;hydrochloride has a molecular weight of 170.60 g/mol, XLogP of 0.75, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydropyrrolo[3,4-c]pyridin-1-one;hydrochloride is sourced from PubChem (CID 141389708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).