C10H10N2O — CID 157152247
6-methyl-2-methylidene-1,4-dihydro-1,5-naphthyridin-3-one (PubChem CID 157152247) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is 6-methyl-2-methylidene-1,4-dihydro-1,5-naphthyridin-3-one.
| Compound Name | 6-methyl-2-methylidene-1,4-dihydro-1,5-naphthyridin-3-one |
|---|---|
| PubChem CID | 157152247 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 6-methyl-2-methylidene-1,4-dihydro-1,5-naphthyridin-3-one |
| SMILES | C=C1Nc2ccc(C)nc2CC1=O |
| InChI | InChI=1S/C10H10N2O/c1-6-3-4-8-9(11-6)5-10(13)7(2)12-8/h3-4,12H,2,5H2,1H3 |
| InChIKey | CQYAXSAQZWGVKP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|