About 2-amino-6-bromo-3,4-dihydro-1H-naphthalene-2-carbonitrile
2-amino-6-bromo-3,4-dihydro-1H-naphthalene-2-carbonitrile (PubChem CID 63630629) has the molecular formula C11H11BrN2
and a molecular weight of 251.13 g/mol. Its IUPAC name is 2-amino-6-bromo-3,4-dihydro-1H-naphthalene-2-carbonitrile.
Molecular Properties
| Compound Name | 2-amino-6-bromo-3,4-dihydro-1H-naphthalene-2-carbonitrile |
| PubChem CID | 63630629 |
| Molecular Formula | C11H11BrN2 |
| Molecular Weight | 251.13 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 2-amino-6-bromo-3,4-dihydro-1H-naphthalene-2-carbonitrile |
| SMILES | N#CC1(N)CCc2cc(Br)ccc2C1 |
| InChI | InChI=1S/C11H11BrN2/c12-10-2-1-9-6-11(14,7-13)4-3-8(9)5-10/h1-2,5H,3-4,6,14H2 |
| InChIKey | PRCHTXIEIQJWNZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.13 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-6-bromo-3,4-dihydro-1H-naphthalene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-bromo-3,4-dihydro-1H-naphthalene-2-carbonitrile?
The IUPAC name of 2-amino-6-bromo-3,4-dihydro-1H-naphthalene-2-carbonitrile (CID 63630629) is 2-amino-6-bromo-3,4-dihydro-1H-naphthalene-2-carbonitrile.
What is the SMILES notation for 2-amino-6-bromo-3,4-dihydro-1H-naphthalene-2-carbonitrile?
The canonical SMILES for 2-amino-6-bromo-3,4-dihydro-1H-naphthalene-2-carbonitrile is N#CC1(N)CCc2cc(Br)ccc2C1.
What is the InChIKey of 2-amino-6-bromo-3,4-dihydro-1H-naphthalene-2-carbonitrile?
The InChIKey is PRCHTXIEIQJWNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrN2/c12-10-2-1-9-6-11(14,7-13)4-3-8(9)5-10/h1-2,5H,3-4,6,14H2.
What are the key properties of 2-amino-6-bromo-3,4-dihydro-1H-naphthalene-2-carbonitrile?
2-amino-6-bromo-3,4-dihydro-1H-naphthalene-2-carbonitrile has a molecular weight of 251.13 g/mol, XLogP of 2.16, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-bromo-3,4-dihydro-1H-naphthalene-2-carbonitrile is sourced from PubChem (CID 63630629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).