C11H7BrN2O — CID 82884243
5-bromo-1-isocyanato-2,3-dihydroindene-1-carbonitrile (PubChem CID 82884243) has the molecular formula C11H7BrN2O and a molecular weight of 263.09 g/mol. Its IUPAC name is 5-bromo-1-isocyanato-2,3-dihydroindene-1-carbonitrile.
| Compound Name | 5-bromo-1-isocyanato-2,3-dihydroindene-1-carbonitrile |
|---|---|
| PubChem CID | 82884243 |
| Molecular Formula | C11H7BrN2O |
| Molecular Weight | 263.09 g/mol |
| Exact Mass | 261.97 |
| IUPAC Name | 5-bromo-1-isocyanato-2,3-dihydroindene-1-carbonitrile |
| SMILES | N#CC1(N=C=O)CCc2cc(Br)ccc21 |
| InChI | InChI=1S/C11H7BrN2O/c12-9-1-2-10-8(5-9)3-4-11(10,6-13)14-7-15/h1-2,5H,3-4H2 |
| InChIKey | SXEINSOYTLMSCI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 53.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.09 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|