C16H11BrClN — CID 174509333
5-bromo-1-(4-chlorophenyl)-2,3-dihydroindene-1-carbonitrile (PubChem CID 174509333) has the molecular formula C16H11BrClN and a molecular weight of 332.63 g/mol. Its IUPAC name is 5-bromo-1-(4-chlorophenyl)-2,3-dihydroindene-1-carbonitrile.
| Compound Name | 5-bromo-1-(4-chlorophenyl)-2,3-dihydroindene-1-carbonitrile |
|---|---|
| PubChem CID | 174509333 |
| Molecular Formula | C16H11BrClN |
| Molecular Weight | 332.63 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 5-bromo-1-(4-chlorophenyl)-2,3-dihydroindene-1-carbonitrile |
| SMILES | N#CC1(c2ccc(Cl)cc2)CCc2cc(Br)ccc21 |
| InChI | InChI=1S/C16H11BrClN/c17-13-3-6-15-11(9-13)7-8-16(15,10-19)12-1-4-14(18)5-2-12/h1-6,9H,7-8H2 |
| InChIKey | QTLOERXIZDBQRM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.63 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |