C10H7BrINOS — CID 146633603
(5-bromo-1-cyano-2,3-dihydroinden-1-yl)oxy thiohypoiodite (PubChem CID 146633603) has the molecular formula C10H7BrINOS and a molecular weight of 396.05 g/mol. Its IUPAC name is (5-bromo-1-cyano-2,3-dihydroinden-1-yl)oxy thiohypoiodite.
| Compound Name | (5-bromo-1-cyano-2,3-dihydroinden-1-yl)oxy thiohypoiodite |
|---|---|
| PubChem CID | 146633603 |
| Molecular Formula | C10H7BrINOS |
| Molecular Weight | 396.05 g/mol |
| Exact Mass | 394.85 |
| IUPAC Name | (5-bromo-1-cyano-2,3-dihydroinden-1-yl)oxy thiohypoiodite |
| SMILES | N#CC1(OSI)CCc2cc(Br)ccc21 |
| InChI | InChI=1S/C10H7BrINOS/c11-8-1-2-9-7(5-8)3-4-10(9,6-13)14-15-12/h1-2,5H,3-4H2 |
| InChIKey | XVGAZFCNXJYUIU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.05 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|