C11H8N2O2 — CID 107150442
4-isocyanato-1,3-dihydroisochromene-4-carbonitrile (PubChem CID 107150442) has the molecular formula C11H8N2O2 and a molecular weight of 200.20 g/mol. Its IUPAC name is 4-isocyanato-1,3-dihydroisochromene-4-carbonitrile.
| Compound Name | 4-isocyanato-1,3-dihydroisochromene-4-carbonitrile |
|---|---|
| PubChem CID | 107150442 |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 4-isocyanato-1,3-dihydroisochromene-4-carbonitrile |
| SMILES | N#CC1(N=C=O)COCc2ccccc21 |
| InChI | InChI=1S/C11H8N2O2/c12-6-11(13-8-14)7-15-5-9-3-1-2-4-10(9)11/h1-4H,5,7H2 |
| InChIKey | KGNOHQJKBSDCLK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|