C12H11NO3 — CID 156818845
4-cyano-4-methyl-1,3-dihydroisochromene-6-carboxylic acid (PubChem CID 156818845) has the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. Its IUPAC name is 4-cyano-4-methyl-1,3-dihydroisochromene-6-carboxylic acid.
| Compound Name | 4-cyano-4-methyl-1,3-dihydroisochromene-6-carboxylic acid |
|---|---|
| PubChem CID | 156818845 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 4-cyano-4-methyl-1,3-dihydroisochromene-6-carboxylic acid |
| SMILES | CC1(C#N)COCc2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C12H11NO3/c1-12(6-13)7-16-5-9-3-2-8(11(14)15)4-10(9)12/h2-4H,5,7H2,1H3,(H,14,15) |
| InChIKey | XXWHXXGCVNIBPQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |