About 7,7-diisocyanatobicyclo[4.1.0]hepta-1,3,5-triene
7,7-diisocyanatobicyclo[4.1.0]hepta-1,3,5-triene (PubChem CID 18474449) has the molecular formula C9H4N2O2
and a molecular weight of 172.14 g/mol. Its IUPAC name is 7,7-diisocyanatobicyclo[4.1.0]hepta-1,3,5-triene.
Molecular Properties
| Compound Name | 7,7-diisocyanatobicyclo[4.1.0]hepta-1,3,5-triene |
| PubChem CID | 18474449 |
| Molecular Formula | C9H4N2O2 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 7,7-diisocyanatobicyclo[4.1.0]hepta-1,3,5-triene |
| SMILES | O=C=NC1(N=C=O)c2ccccc21 |
| InChI | InChI=1S/C9H4N2O2/c12-5-10-9(11-6-13)7-3-1-2-4-8(7)9/h1-4H |
| InChIKey | AMHDLZCIVMWNMQ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 7,7-diisocyanatobicyclo[4.1.0]hepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-diisocyanatobicyclo[4.1.0]hepta-1,3,5-triene?
The IUPAC name of 7,7-diisocyanatobicyclo[4.1.0]hepta-1,3,5-triene (CID 18474449) is 7,7-diisocyanatobicyclo[4.1.0]hepta-1,3,5-triene.
What is the SMILES notation for 7,7-diisocyanatobicyclo[4.1.0]hepta-1,3,5-triene?
The canonical SMILES for 7,7-diisocyanatobicyclo[4.1.0]hepta-1,3,5-triene is O=C=NC1(N=C=O)c2ccccc21.
What is the InChIKey of 7,7-diisocyanatobicyclo[4.1.0]hepta-1,3,5-triene?
The InChIKey is AMHDLZCIVMWNMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4N2O2/c12-5-10-9(11-6-13)7-3-1-2-4-8(7)9/h1-4H.
What are the key properties of 7,7-diisocyanatobicyclo[4.1.0]hepta-1,3,5-triene?
7,7-diisocyanatobicyclo[4.1.0]hepta-1,3,5-triene has a molecular weight of 172.14 g/mol, XLogP of 0.87, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-diisocyanatobicyclo[4.1.0]hepta-1,3,5-triene is sourced from PubChem (CID 18474449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).