C9H4N2O2 — CID 18474449
7,7-diisocyanatobicyclo[4.1.0]hepta-1,3,5-triene (PubChem CID 18474449) has the molecular formula C9H4N2O2 and a molecular weight of 172.14 g/mol. Its IUPAC name is 7,7-diisocyanatobicyclo[4.1.0]hepta-1,3,5-triene.
| Compound Name | 7,7-diisocyanatobicyclo[4.1.0]hepta-1,3,5-triene |
|---|---|
| PubChem CID | 18474449 |
| Molecular Formula | C9H4N2O2 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 7,7-diisocyanatobicyclo[4.1.0]hepta-1,3,5-triene |
| SMILES | O=C=NC1(N=C=O)c2ccccc21 |
| InChI | InChI=1S/C9H4N2O2/c12-5-10-9(11-6-13)7-3-1-2-4-8(7)9/h1-4H |
| InChIKey | AMHDLZCIVMWNMQ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|