C14H14BrNO2 — CID 63632927
7-bromospiro[2,4-dihydro-1H-naphthalene-3,4'-piperidine]-2',6'-dione (PubChem CID 63632927) has the molecular formula C14H14BrNO2 and a molecular weight of 308.17 g/mol. Its IUPAC name is 7-bromospiro[2,4-dihydro-1H-naphthalene-3,4'-piperidine]-2',6'-dione.
| Compound Name | 7-bromospiro[2,4-dihydro-1H-naphthalene-3,4'-piperidine]-2',6'-dione |
|---|---|
| PubChem CID | 63632927 |
| Molecular Formula | C14H14BrNO2 |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 7-bromospiro[2,4-dihydro-1H-naphthalene-3,4'-piperidine]-2',6'-dione |
| SMILES | O=C1CC2(CCc3cc(Br)ccc3C2)CC(=O)N1 |
| InChI | InChI=1S/C14H14BrNO2/c15-11-2-1-10-6-14(4-3-9(10)5-11)7-12(17)16-13(18)8-14/h1-2,5H,3-4,6-8H2,(H,16,17,18) |
| InChIKey | RFWUYEPPNUUDME-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|