C14H12BrNO2 — CID 77040438
3-(6-bromo-3,4-dihydro-1H-naphthalen-2-ylidene)pyrrolidine-2,5-dione (PubChem CID 77040438) has the molecular formula C14H12BrNO2 and a molecular weight of 306.16 g/mol. Its IUPAC name is 3-(6-bromo-3,4-dihydro-1H-naphthalen-2-ylidene)pyrrolidine-2,5-dione.
| Compound Name | 3-(6-bromo-3,4-dihydro-1H-naphthalen-2-ylidene)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 77040438 |
| Molecular Formula | C14H12BrNO2 |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 3-(6-bromo-3,4-dihydro-1H-naphthalen-2-ylidene)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(=C2CCc3cc(Br)ccc3C2)C(=O)N1 |
| InChI | InChI=1S/C14H12BrNO2/c15-11-4-3-8-5-10(2-1-9(8)6-11)12-7-13(17)16-14(12)18/h3-4,6H,1-2,5,7H2,(H,16,17,18) |
| InChIKey | FNBZSUFJPNTECX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|