C11H8BrNO2 — CID 77040200
3-[(3-bromophenyl)methylidene]pyrrolidine-2,5-dione (PubChem CID 77040200) has the molecular formula C11H8BrNO2 and a molecular weight of 266.09 g/mol. Its IUPAC name is 3-[(3-bromophenyl)methylidene]pyrrolidine-2,5-dione.
| Compound Name | 3-[(3-bromophenyl)methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 77040200 |
| Molecular Formula | C11H8BrNO2 |
| Molecular Weight | 266.09 g/mol |
| Exact Mass | 264.97 |
| IUPAC Name | 3-[(3-bromophenyl)methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(=Cc2cccc(Br)c2)C(=O)N1 |
| InChI | InChI=1S/C11H8BrNO2/c12-9-3-1-2-7(5-9)4-8-6-10(14)13-11(8)15/h1-5H,6H2,(H,13,14,15) |
| InChIKey | FLJVDJUNQPDDTR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.09 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|