About 2,3,4,7-tetrahydro-1H-pyrrolo[2,3-d]pyrimidine
2,3,4,7-tetrahydro-1H-pyrrolo[2,3-d]pyrimidine (PubChem CID 158570723) has the molecular formula C6H9N3
and a molecular weight of 123.16 g/mol. Its IUPAC name is 2,3,4,7-tetrahydro-1H-pyrrolo[2,3-d]pyrimidine.
Analyze 2,3,4,7-tetrahydro-1H-pyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,7-tetrahydro-1H-pyrrolo[2,3-d]pyrimidine?
The IUPAC name of 2,3,4,7-tetrahydro-1H-pyrrolo[2,3-d]pyrimidine (CID 158570723) is 2,3,4,7-tetrahydro-1H-pyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 2,3,4,7-tetrahydro-1H-pyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 2,3,4,7-tetrahydro-1H-pyrrolo[2,3-d]pyrimidine is c1cc2c([nH]1)NCNC2.
What is the InChIKey of 2,3,4,7-tetrahydro-1H-pyrrolo[2,3-d]pyrimidine?
The InChIKey is UQWCHGVIOGOCGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3/c1-2-8-6-5(1)3-7-4-9-6/h1-2,7-9H,3-4H2.
What are the key properties of 2,3,4,7-tetrahydro-1H-pyrrolo[2,3-d]pyrimidine?
2,3,4,7-tetrahydro-1H-pyrrolo[2,3-d]pyrimidine has a molecular weight of 123.16 g/mol, XLogP of 0.49, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,7-tetrahydro-1H-pyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 158570723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).